C23H27NO5 — CID 23919134
[(1R)-1-[3-(2-hydroxyethoxy)phenyl]-6-methyl-5-methylidene-4-oxoheptyl] pyridine-3-carboxylate (PubChem CID 23919134) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [(1R)-1-[3-(2-hydroxyethoxy)phenyl]-6-methyl-5-methylidene-4-oxoheptyl] pyridine-3-carboxylate.
| Compound Name | [(1R)-1-[3-(2-hydroxyethoxy)phenyl]-6-methyl-5-methylidene-4-oxoheptyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23919134 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [(1R)-1-[3-(2-hydroxyethoxy)phenyl]-6-methyl-5-methylidene-4-oxoheptyl] pyridine-3-carboxylate |
| SMILES | C=C(C(=O)CC[C@@H](OC(=O)c1cccnc1)c1cccc(OCCO)c1)C(C)C |
| InChI | InChI=1S/C23H27NO5/c1-16(2)17(3)21(26)9-10-22(29-23(27)19-7-5-11-24-15-19)18-6-4-8-20(14-18)28-13-12-25/h4-8,11,14-16,22,25H,3,9-10,12-13H2,1-2H3/t22-/m1/s1 |
| InChIKey | FWMGOGVGDNQMGU-JOCHJYFZSA-N |
| XLogP | 3.91 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|