C20H28O5 — CID 23975112
[(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-oxononyl] acetate (PubChem CID 23975112) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-oxononyl] acetate.
| Compound Name | [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-oxononyl] acetate |
|---|---|
| PubChem CID | 23975112 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-oxononyl] acetate |
| SMILES | C=C(CCCC)C(=O)CC[C@H](OC(C)=O)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C20H28O5/c1-4-5-7-15(2)19(23)10-11-20(25-16(3)22)17-8-6-9-18(14-17)24-13-12-21/h6,8-9,14,20-21H,2,4-5,7,10-13H2,1,3H3/t20-/m0/s1 |
| InChIKey | QQAWYUQCFPZEFD-FQEVSTJZSA-N |
| XLogP | 3.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|