C17H24O5 — CID 23863813
[(1R)-1-[5-(hydroxymethyl)furan-2-yl]-5-methylidene-4-oxononyl] acetate (PubChem CID 23863813) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(1R)-1-[5-(hydroxymethyl)furan-2-yl]-5-methylidene-4-oxononyl] acetate.
| Compound Name | [(1R)-1-[5-(hydroxymethyl)furan-2-yl]-5-methylidene-4-oxononyl] acetate |
|---|---|
| PubChem CID | 23863813 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1R)-1-[5-(hydroxymethyl)furan-2-yl]-5-methylidene-4-oxononyl] acetate |
| SMILES | C=C(CCCC)C(=O)CC[C@@H](OC(C)=O)c1ccc(CO)o1 |
| InChI | InChI=1S/C17H24O5/c1-4-5-6-12(2)15(20)8-10-16(21-13(3)19)17-9-7-14(11-18)22-17/h7,9,16,18H,2,4-6,8,10-11H2,1,3H3/t16-/m1/s1 |
| InChIKey | YCVWDLTYZFPNMN-MRXNPFEDSA-N |
| XLogP | 3.47 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|