C33H34N2O4 — CID 23947559
[(Z,1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] pyridine-4-carboxylate (PubChem CID 23947559) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is [(Z,1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] pyridine-4-carboxylate.
| Compound Name | [(Z,1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 23947559 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [(Z,1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-methylidene-4-quinolin-3-ylnon-3-enyl] pyridine-4-carboxylate |
| SMILES | C=C(CCCC)/C(=C/C[C@H](OC(=O)c1ccncc1)c1cccc(OCCO)c1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C33H34N2O4/c1-3-4-8-24(2)30(28-21-26-9-5-6-12-31(26)35-23-28)13-14-32(39-33(37)25-15-17-34-18-16-25)27-10-7-11-29(22-27)38-20-19-36/h5-7,9-13,15-18,21-23,32,36H,2-4,8,14,19-20H2,1H3/b30-13-/t32-/m0/s1 |
| InChIKey | NZAXTSFOVXNHFM-IGKLTIGNSA-N |
| XLogP | 7.12 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|