C21H19N4O4+ — CID 2375010
2-(3,7-dibenzyl-2,6-dioxo-9H-purin-7-ium-1-yl)acetic acid (PubChem CID 2375010) has the molecular formula C21H19N4O4+ and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-(3,7-dibenzyl-2,6-dioxo-9H-purin-7-ium-1-yl)acetic acid.
| Compound Name | 2-(3,7-dibenzyl-2,6-dioxo-9H-purin-7-ium-1-yl)acetic acid |
|---|---|
| PubChem CID | 2375010 |
| Molecular Formula | C21H19N4O4+ |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(3,7-dibenzyl-2,6-dioxo-9H-purin-7-ium-1-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)c2c([nH]c[n+]2Cc2ccccc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H18N4O4/c26-17(27)13-25-20(28)18-19(22-14-23(18)11-15-7-3-1-4-8-15)24(21(25)29)12-16-9-5-2-6-10-16/h1-10,14H,11-13H2,(H,26,27)/p+1 |
| InChIKey | SBPCVHSIKOVVDH-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|