C33H36N4O3 — CID 23760083
1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 23760083) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 23760083 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | CO[C@H](c1ccc(N2C(=O)CCc3ccccc32)cc1)[C@H](C)/C=C/CCn1cc(C(CO)c2ccccc2)nn1 |
| InChI | InChI=1S/C33H36N4O3/c1-24(10-8-9-21-36-22-30(34-35-36)29(23-38)25-11-4-3-5-12-25)33(40-2)27-15-18-28(19-16-27)37-31-14-7-6-13-26(31)17-20-32(37)39/h3-8,10-16,18-19,22,24,29,33,38H,9,17,20-21,23H2,1-2H3/b10-8+/t24-,29?,33+/m1/s1 |
| InChIKey | ZBLFRYUCDPHUEB-WCQBPBSJSA-N |
| XLogP | 5.98 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|