C28H35N5O3 — CID 23760082
1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]piperazin-2-one (PubChem CID 23760082) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]piperazin-2-one.
| Compound Name | 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 23760082 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 1-[4-[(E,1S,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]-1-methoxy-2-methylhex-3-enyl]phenyl]piperazin-2-one |
| SMILES | CO[C@H](c1ccc(N2CCNCC2=O)cc1)[C@H](C)/C=C/CCn1cc(C(CO)c2ccccc2)nn1 |
| InChI | InChI=1S/C28H35N5O3/c1-21(28(36-2)23-11-13-24(14-12-23)33-17-15-29-18-27(33)35)8-6-7-16-32-19-26(30-31-32)25(20-34)22-9-4-3-5-10-22/h3-6,8-14,19,21,25,28-29,34H,7,15-18,20H2,1-2H3/b8-6+/t21-,25?,28+/m1/s1 |
| InChIKey | ZNPSVCKWRPGTSH-XTDXHXSRSA-N |
| XLogP | 3.31 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|