C22H28N6O4 — CID 23901905
(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperazin-1-yl)-1H-indol-2-one (PubChem CID 23901905) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperazin-1-yl)-1H-indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperazin-1-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 23901905 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperazin-1-yl)-1H-indol-2-one |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)Nc2ccc(N3CCNCC3=O)cc21 |
| InChI | InChI=1S/C22H28N6O4/c1-15(4-2-3-9-27-14-16(7-11-29)25-26-27)22(32)18-12-17(5-6-19(18)24-21(22)31)28-10-8-23-13-20(28)30/h2,4-6,12,14-15,23,29,32H,3,7-11,13H2,1H3,(H,24,31)/b4-2+/t15-,22+/m0/s1 |
| InChIKey | QXICAUGMGBERCK-CLGHRCLESA-N |
| XLogP | 0.17 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|