C17H24N3O3PS2 — CID 23766478
2-(1,3-benzoxazol-2-ylsulfanyl)ethyl-dimorpholin-4-yl-sulfanylidene-λ5-phosphane (PubChem CID 23766478) has the molecular formula C17H24N3O3PS2 and a molecular weight of 413.51 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)ethyl-dimorpholin-4-yl-sulfanylidene-λ5-phosphane.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)ethyl-dimorpholin-4-yl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23766478 |
| Molecular Formula | C17H24N3O3PS2 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)ethyl-dimorpholin-4-yl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(CCSc1nc2ccccc2o1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C17H24N3O3PS2/c25-24(19-5-9-21-10-6-19,20-7-11-22-12-8-20)13-14-26-17-18-15-3-1-2-4-16(15)23-17/h1-4H,5-14H2 |
| InChIKey | PQAKKWLMHPLLPZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|