C30H40BNO5 — CID 23775895
(4R,6aR,9aS,9bR)-8-cyclohexyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-methyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione (PubChem CID 23775895) has the molecular formula C30H40BNO5 and a molecular weight of 505.46 g/mol. Its IUPAC name is (4R,6aR,9aS,9bR)-8-cyclohexyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-methyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione.
| Compound Name | (4R,6aR,9aS,9bR)-8-cyclohexyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-methyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
|---|---|
| PubChem CID | 23775895 |
| Molecular Formula | C30H40BNO5 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | (4R,6aR,9aS,9bR)-8-cyclohexyl-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-methyl-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-7,9-dione |
| SMILES | CCC/C(=C\c1ccc(O)cc1)CC[C@H]1OB(O)C[C@H]2C1=C(C)C[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H40BNO5/c1-3-7-20(17-21-10-13-23(33)14-11-21)12-15-26-27-19(2)16-24-28(25(27)18-31(36)37-26)30(35)32(29(24)34)22-8-5-4-6-9-22/h10-11,13-14,17,22,24-26,28,33,36H,3-9,12,15-16,18H2,1-2H3/b20-17+/t24-,25+,26-,28-/m1/s1 |
| InChIKey | FCHHINNJUYURTQ-SKTNAUHZSA-N |
| XLogP | 5.51 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|