C15H16N2O4 — CID 23831647
(2-oxo-2-piperidin-1-ylethyl) 1,3-benzoxazole-4-carboxylate (PubChem CID 23831647) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 1,3-benzoxazole-4-carboxylate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 23831647 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 1,3-benzoxazole-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1cccc2ocnc12 |
| InChI | InChI=1S/C15H16N2O4/c18-13(17-7-2-1-3-8-17)9-20-15(19)11-5-4-6-12-14(11)16-10-21-12/h4-6,10H,1-3,7-9H2 |
| InChIKey | QBIVYFTUKYNFNB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |