C24H22N4O — CID 23851656
3-(benzylamino)-4-benzylimino-10-methylpyrido[1,2-a][1,3]diazepin-5-one (PubChem CID 23851656) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-(benzylamino)-4-benzylimino-10-methylpyrido[1,2-a][1,3]diazepin-5-one.
| Compound Name | 3-(benzylamino)-4-benzylimino-10-methylpyrido[1,2-a][1,3]diazepin-5-one |
|---|---|
| PubChem CID | 23851656 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(benzylamino)-4-benzylimino-10-methylpyrido[1,2-a][1,3]diazepin-5-one |
| SMILES | Cc1cccn2c(=O)/c(=N\Cc3ccccc3)c(NCc3ccccc3)cnc12 |
| InChI | InChI=1S/C24H22N4O/c1-18-9-8-14-28-23(18)27-17-21(25-15-19-10-4-2-5-11-19)22(24(28)29)26-16-20-12-6-3-7-13-20/h2-14,17,25H,15-16H2,1H3/b26-22- |
| InChIKey | FKCURHVRNRUXLT-ROMGYVFFSA-N |
| XLogP | 3.72 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |