About (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate
(3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate (PubChem CID 23857076) has the molecular formula C21H12N2O4
and a molecular weight of 356.34 g/mol. Its IUPAC name is (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate.
Molecular Properties
| Compound Name | (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate |
| PubChem CID | 23857076 |
| Molecular Formula | C21H12N2O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate |
| SMILES | N#Cc1cc2ccc(OC(=O)c3ccc(-n4cccc4)cc3)cc2oc1=O |
| InChI | InChI=1S/C21H12N2O4/c22-13-16-11-15-5-8-18(12-19(15)27-21(16)25)26-20(24)14-3-6-17(7-4-14)23-9-1-2-10-23/h1-12H |
| InChIKey | PXGCYYOFEGPYSK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate?
The IUPAC name of (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate (CID 23857076) is (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate.
What is the SMILES notation for (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate?
The canonical SMILES for (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate is N#Cc1cc2ccc(OC(=O)c3ccc(-n4cccc4)cc3)cc2oc1=O.
What is the InChIKey of (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate?
The InChIKey is PXGCYYOFEGPYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N2O4/c22-13-16-11-15-5-8-18(12-19(15)27-21(16)25)26-20(24)14-3-6-17(7-4-14)23-9-1-2-10-23/h1-12H.
What are the key properties of (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate?
(3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate has a molecular weight of 356.34 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-2-oxochromen-7-yl) 4-pyrrol-1-ylbenzoate is sourced from PubChem (CID 23857076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).