C29H36N2O3 — CID 23859508
4-[4-(diethylamino)phenyl]-1-(4-ethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23859508) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]-1-(4-ethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4-[4-(diethylamino)phenyl]-1-(4-ethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23859508 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]-1-(4-ethoxyphenyl)-7,7-dimethyl-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)CC(c3ccc(N(CC)CC)cc3)C3=C2CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C29H36N2O3/c1-6-30(7-2)21-11-9-20(10-12-21)24-17-27(33)31(22-13-15-23(16-14-22)34-8-3)25-18-29(4,5)19-26(32)28(24)25/h9-16,24H,6-8,17-19H2,1-5H3 |
| InChIKey | UTYSKFABGSBLGA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|