C23H20ClN3O3S2 — CID 23903486
ethyl 4-(2-chlorophenyl)-2-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 23903486) has the molecular formula C23H20ClN3O3S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-2-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2-chlorophenyl)-2-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23903486 |
| Molecular Formula | C23H20ClN3O3S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-2-[[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CSc1nc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C23H20ClN3O3S2/c1-3-30-22(29)20-15(14-6-4-5-7-16(14)24)11-31-21(20)27-19(28)12-32-23-25-17-9-8-13(2)10-18(17)26-23/h4-11H,3,12H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | ZGBPOFUFHFJRAP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|