C20H16ClNO6S — CID 46649168
[2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] furan-3-carboxylate (PubChem CID 46649168) has the molecular formula C20H16ClNO6S and a molecular weight of 433.87 g/mol. Its IUPAC name is [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 46649168 |
| Molecular Formula | C20H16ClNO6S |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)COC(=O)c1ccoc1 |
| InChI | InChI=1S/C20H16ClNO6S/c1-2-27-20(25)17-14(13-5-3-4-6-15(13)21)11-29-18(17)22-16(23)10-28-19(24)12-7-8-26-9-12/h3-9,11H,2,10H2,1H3,(H,22,23) |
| InChIKey | FCWVADKFNMKAPY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|