C23H20ClNO6S — CID 23761318
ethyl 4-(2-chlorophenyl)-2-[[2-(2-hydroxy-2-phenylacetyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 23761318) has the molecular formula C23H20ClNO6S and a molecular weight of 473.93 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-2-[[2-(2-hydroxy-2-phenylacetyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2-chlorophenyl)-2-[[2-(2-hydroxy-2-phenylacetyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23761318 |
| Molecular Formula | C23H20ClNO6S |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-2-[[2-(2-hydroxy-2-phenylacetyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)COC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C23H20ClNO6S/c1-2-30-22(28)19-16(15-10-6-7-11-17(15)24)13-32-21(19)25-18(26)12-31-23(29)20(27)14-8-4-3-5-9-14/h3-11,13,20,27H,2,12H2,1H3,(H,25,26) |
| InChIKey | HLPRHMVPURYDJB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|