C24H18ClN3O5S — CID 30031853
[2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] quinoxaline-2-carboxylate (PubChem CID 30031853) has the molecular formula C24H18ClN3O5S and a molecular weight of 495.94 g/mol. Its IUPAC name is [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 30031853 |
| Molecular Formula | C24H18ClN3O5S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [2-[[4-(2-chlorophenyl)-3-ethoxycarbonylthiophen-2-yl]amino]-2-oxoethyl] quinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)COC(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C24H18ClN3O5S/c1-2-32-24(31)21-15(14-7-3-4-8-16(14)25)13-34-22(21)28-20(29)12-33-23(30)19-11-26-17-9-5-6-10-18(17)27-19/h3-11,13H,2,12H2,1H3,(H,28,29) |
| InChIKey | TVQNWICJXFUDJT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|