C12H7BrClN3O5S — CID 23936870
[2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 23936870) has the molecular formula C12H7BrClN3O5S and a molecular weight of 420.63 g/mol. Its IUPAC name is [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 23936870 |
| Molecular Formula | C12H7BrClN3O5S |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 418.90 |
| IUPAC Name | [2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1[N+](=O)[O-])Nc1ncc(Br)s1 |
| InChI | InChI=1S/C12H7BrClN3O5S/c13-9-4-15-12(23-9)16-10(18)5-22-11(19)7-3-6(14)1-2-8(7)17(20)21/h1-4H,5H2,(H,15,16,18) |
| InChIKey | ZRQUUTPJDSIFKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|