C27H30N4O3S — CID 23972945
2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-cyclohexyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide (PubChem CID 23972945) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-cyclohexyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide.
| Compound Name | 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-cyclohexyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 23972945 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-cyclohexyl-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide |
| SMILES | CCCc1ccc(C#N)c(SCC(=O)N(C2CCCCC2)C2CC(=O)N(c3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C27H30N4O3S/c1-2-9-20-15-14-19(17-28)26(29-20)35-18-25(33)30(21-10-5-3-6-11-21)23-16-24(32)31(27(23)34)22-12-7-4-8-13-22/h4,7-8,12-15,21,23H,2-3,5-6,9-11,16,18H2,1H3 |
| InChIKey | KERAUQWNMPDQOX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|