C20H28N2O6 — CID 23975343
(4R)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23975343) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is (4R)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23975343 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (4R)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@]1(C(=O)NCC(OC)OC)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C20H28N2O6/c1-4-10-20(19(24)21-13-17(25-2)26-3)14-28-18(22-20)15-6-8-16(9-7-15)27-12-5-11-23/h4,6-9,17,23H,1,5,10-14H2,2-3H3,(H,21,24)/t20-/m1/s1 |
| InChIKey | DDTPITOQHHXNLO-HXUWFJFHSA-N |
| XLogP | 1.27 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|