C20H23F2N3O4S — CID 2401208
3-[[1-[2-(difluoromethoxy)phenyl]ethenylamino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 2401208) has the molecular formula C20H23F2N3O4S and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-[[1-[2-(difluoromethoxy)phenyl]ethenylamino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[1-[2-(difluoromethoxy)phenyl]ethenylamino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2401208 |
| Molecular Formula | C20H23F2N3O4S |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[[1-[2-(difluoromethoxy)phenyl]ethenylamino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | C=C(NNC(=O)c1cccc(S(=O)(=O)N(CC)CC)c1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H23F2N3O4S/c1-4-25(5-2)30(27,28)16-10-8-9-15(13-16)19(26)24-23-14(3)17-11-6-7-12-18(17)29-20(21)22/h6-13,20,23H,3-5H2,1-2H3,(H,24,26) |
| InChIKey | AIMAGKHMTHSJHE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|