C31H23N3O3S — CID 2425327
(4Z)-2-[(4-methoxyphenyl)methyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]isoquinoline-1,3-dione (PubChem CID 2425327) has the molecular formula C31H23N3O3S and a molecular weight of 517.61 g/mol. Its IUPAC name is (4Z)-2-[(4-methoxyphenyl)methyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-2-[(4-methoxyphenyl)methyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2425327 |
| Molecular Formula | C31H23N3O3S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (4Z)-2-[(4-methoxyphenyl)methyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]isoquinoline-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)/C(=C\c3cn(-c4ccccc4)nc3-c3cccs3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C31H23N3O3S/c1-37-24-15-13-21(14-16-24)19-33-30(35)26-11-6-5-10-25(26)27(31(33)36)18-22-20-34(23-8-3-2-4-9-23)32-29(22)28-12-7-17-38-28/h2-18,20H,19H2,1H3/b27-18- |
| InChIKey | MIMBVYAFPXCPNH-IMRQLAEWSA-N |
| XLogP | 6.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|