C15H14BrNO6 — CID 2429730
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2429730) has the molecular formula C15H14BrNO6 and a molecular weight of 384.18 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2429730 |
| Molecular Formula | C15H14BrNO6 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccc(Br)o2)cc1OC |
| InChI | InChI=1S/C15H14BrNO6/c1-20-10-4-3-9(7-12(10)21-2)17-14(18)8-22-15(19)11-5-6-13(16)23-11/h3-7H,8H2,1-2H3,(H,17,18) |
| InChIKey | YHJCSMNRODVJGP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |