C20H24N2O5 — CID 2438190
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 2438190) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 2438190 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1C |
| InChI | InChI=1S/C20H24N2O5/c1-12-8-14(3)15(9-13(12)2)16(23)11-27-17(24)10-22-18(25)20(21-19(22)26)6-4-5-7-20/h8-9H,4-7,10-11H2,1-3H3,(H,21,26) |
| InChIKey | QZILXOWBWKIMBU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|