C19H20ClN7O2S2 — CID 24519437
1-[3-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 24519437) has the molecular formula C19H20ClN7O2S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 1-[3-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 24519437 |
| Molecular Formula | C19H20ClN7O2S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-[3-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cc1ccc(Nc2nnc(SCCCn3c(=O)c4c(ncn4C)n(C)c3=O)s2)cc1Cl |
| InChI | InChI=1S/C19H20ClN7O2S2/c1-11-5-6-12(9-13(11)20)22-17-23-24-18(31-17)30-8-4-7-27-16(28)14-15(21-10-25(14)2)26(3)19(27)29/h5-6,9-10H,4,7-8H2,1-3H3,(H,22,23) |
| InChIKey | CJSZZVPUKCHDGL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|