C24H31N7O5 — CID 24524055
[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 24524055) has the molecular formula C24H31N7O5 and a molecular weight of 497.56 g/mol. Its IUPAC name is [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 24524055 |
| Molecular Formula | C24H31N7O5 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | COc1ccccc1Nc1nc(N)nc(COC(=O)CN2C(=O)NC3(CC(C)CC(C)(C)C3)C2=O)n1 |
| InChI | InChI=1S/C24H31N7O5/c1-14-9-23(2,3)13-24(10-14)19(33)31(22(34)30-24)11-18(32)36-12-17-27-20(25)29-21(28-17)26-15-7-5-6-8-16(15)35-4/h5-8,14H,9-13H2,1-4H3,(H,30,34)(H3,25,26,27,28,29) |
| InChIKey | ULDXALUAJHVPKI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|