C23H29N7O4 — CID 55384487
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55384487) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55384487 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OCc1nc(N)nc(Nc3ccccc3)n1)C2=O |
| InChI | InChI=1S/C23H29N7O4/c1-14-9-22(2,3)13-23(10-14)18(32)30(21(33)29-23)11-17(31)34-12-16-26-19(24)28-20(27-16)25-15-7-5-4-6-8-15/h4-8,14H,9-13H2,1-3H3,(H,29,33)(H3,24,25,26,27,28) |
| InChIKey | IVGAUPPXMUVNGN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|