C18H14N2O6 — CID 24542248
4-[[(E)-2-cyano-3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoyl]amino]benzoic acid (PubChem CID 24542248) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-2-cyano-3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 24542248 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[[(E)-2-cyano-3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoyl]amino]benzoic acid |
| SMILES | COC(=O)c1cc(/C=C(\C#N)C(=O)Nc2ccc(C(=O)O)cc2)oc1C |
| InChI | InChI=1S/C18H14N2O6/c1-10-15(18(24)25-2)8-14(26-10)7-12(9-19)16(21)20-13-5-3-11(4-6-13)17(22)23/h3-8H,1-2H3,(H,20,21)(H,22,23)/b12-7+ |
| InChIKey | UEUYOVNWHPVLTA-KPKJPENVSA-N |
| XLogP | 2.62 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|