C17H12Cl2N2O4 — CID 27718233
methyl 5-[(E)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate (PubChem CID 27718233) has the molecular formula C17H12Cl2N2O4 and a molecular weight of 379.20 g/mol. Its IUPAC name is methyl 5-[(E)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(E)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 27718233 |
| Molecular Formula | C17H12Cl2N2O4 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | methyl 5-[(E)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(/C=C(\C#N)C(=O)Nc2ccc(Cl)cc2Cl)oc1C |
| InChI | InChI=1S/C17H12Cl2N2O4/c1-9-13(17(23)24-2)7-12(25-9)5-10(8-20)16(22)21-15-4-3-11(18)6-14(15)19/h3-7H,1-2H3,(H,21,22)/b10-5+ |
| InChIKey | RGYYLSAJZFGTGY-BJMVGYQFSA-N |
| XLogP | 4.23 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|