C18H13Cl2NS — CID 2455036
N-[(2,4-dichlorophenyl)methyl]naphthalene-1-carbothioamide (PubChem CID 2455036) has the molecular formula C18H13Cl2NS and a molecular weight of 346.28 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]naphthalene-1-carbothioamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]naphthalene-1-carbothioamide |
|---|---|
| PubChem CID | 2455036 |
| Molecular Formula | C18H13Cl2NS |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]naphthalene-1-carbothioamide |
| SMILES | S=C(NCc1ccc(Cl)cc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H13Cl2NS/c19-14-9-8-13(17(20)10-14)11-21-18(22)16-7-3-5-12-4-1-2-6-15(12)16/h1-10H,11H2,(H,21,22) |
| InChIKey | VANNLGUBOBFSEM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|