C12H21N2O3S+ — CID 2455455
[3-(dimethylsulfamoyl)phenyl]methyl-[(2R)-2-hydroxypropyl]azanium (PubChem CID 2455455) has the molecular formula C12H21N2O3S+ and a molecular weight of 273.38 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl-[(2R)-2-hydroxypropyl]azanium.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl-[(2R)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2455455 |
| Molecular Formula | C12H21N2O3S+ |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl-[(2R)-2-hydroxypropyl]azanium |
| SMILES | C[C@@H](O)C[NH2+]Cc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H20N2O3S/c1-10(15)8-13-9-11-5-4-6-12(7-11)18(16,17)14(2)3/h4-7,10,13,15H,8-9H2,1-3H3/p+1/t10-/m1/s1 |
| InChIKey | MXIYAYFNNYFXKC-SNVBAGLBSA-O |
| XLogP | -0.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |