C22H22N2O2S2 — CID 24595739
3-(cyclopropanecarbonylamino)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]naphthalene-2-carboxamide (PubChem CID 24595739) has the molecular formula C22H22N2O2S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]naphthalene-2-carboxamide.
| Compound Name | 3-(cyclopropanecarbonylamino)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24595739 |
| Molecular Formula | C22H22N2O2S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCSCc1cccs1)c1cc2ccccc2cc1NC(=O)C1CC1 |
| InChI | InChI=1S/C22H22N2O2S2/c25-21(15-7-8-15)24-20-13-17-5-2-1-4-16(17)12-19(20)22(26)23-9-11-27-14-18-6-3-10-28-18/h1-6,10,12-13,15H,7-9,11,14H2,(H,23,26)(H,24,25) |
| InChIKey | SISDGRUDPWRLPN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|