C24H28N4O5 — CID 24596736
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N'-(4-hexoxybenzoyl)benzohydrazide (PubChem CID 24596736) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N'-(4-hexoxybenzoyl)benzohydrazide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N'-(4-hexoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 24596736 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N'-(4-hexoxybenzoyl)benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)c2ccccc2CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C24H28N4O5/c1-2-3-4-7-14-33-19-12-10-17(11-13-19)22(30)26-27-23(31)20-9-6-5-8-18(20)16-28-21(29)15-25-24(28)32/h5-6,8-13H,2-4,7,14-16H2,1H3,(H,25,32)(H,26,30)(H,27,31) |
| InChIKey | BNKIMUQLCPXHMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|