C23H18N4O3 — CID 24616172
3-methyl-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 24616172) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-methyl-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 24616172 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-methyl-N'-[(E)-3-naphthalen-1-ylprop-2-enoyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)/C=C/c2cccc3ccccc23)c2ccccc2c1=O |
| InChI | InChI=1S/C23H18N4O3/c1-27-23(30)19-12-5-4-11-18(19)21(26-27)22(29)25-24-20(28)14-13-16-9-6-8-15-7-2-3-10-17(15)16/h2-14H,1H3,(H,24,28)(H,25,29)/b14-13+ |
| InChIKey | LVUIHAPBGHMNMC-BUHFOSPRSA-N |
| XLogP | 2.56 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|