C25H19N5O5 — CID 24636765
3-benzyl-N'-[(E)-3-(2-nitrophenyl)prop-2-enoyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 24636765) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-benzyl-N'-[(E)-3-(2-nitrophenyl)prop-2-enoyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-benzyl-N'-[(E)-3-(2-nitrophenyl)prop-2-enoyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 24636765 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 3-benzyl-N'-[(E)-3-(2-nitrophenyl)prop-2-enoyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])NNC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H19N5O5/c31-22(15-14-18-10-4-7-13-21(18)30(34)35)26-27-24(32)23-19-11-5-6-12-20(19)25(33)29(28-23)16-17-8-2-1-3-9-17/h1-15H,16H2,(H,26,31)(H,27,32)/b15-14+ |
| InChIKey | QVFHADCNGBOITJ-CCEZHUSRSA-N |
| XLogP | 2.83 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|