C19H15N3O5S2 — CID 24619260
(5Z)-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 24619260) has the molecular formula C19H15N3O5S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (5Z)-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 24619260 |
| Molecular Formula | C19H15N3O5S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (5Z)-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccs2)C(=O)N1CC(=O)N1CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H15N3O5S2/c23-17(20-7-1-3-12-9-13(22(26)27)5-6-15(12)20)11-21-18(24)16(29-19(21)25)10-14-4-2-8-28-14/h2,4-6,8-10H,1,3,7,11H2/b16-10- |
| InChIKey | INPILSYUJJRKQU-YBEGLDIGSA-N |
| XLogP | 3.67 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|