C19H22F3N3O6S — CID 24621042
1,1,1-trifluoro-2-(5-methylfuran-2-yl)-4-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)butan-2-ol (PubChem CID 24621042) has the molecular formula C19H22F3N3O6S and a molecular weight of 477.46 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(5-methylfuran-2-yl)-4-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(5-methylfuran-2-yl)-4-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)butan-2-ol |
|---|---|
| PubChem CID | 24621042 |
| Molecular Formula | C19H22F3N3O6S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1,1,1-trifluoro-2-(5-methylfuran-2-yl)-4-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)butan-2-ol |
| SMILES | Cc1ccc(C(O)(CCNc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])C(F)(F)F)o1 |
| InChI | InChI=1S/C19H22F3N3O6S/c1-13-4-7-17(31-13)18(26,19(20,21)22)8-9-23-15-6-5-14(12-16(15)25(27)28)32(29,30)24-10-2-3-11-24/h4-7,12,23,26H,2-3,8-11H2,1H3 |
| InChIKey | WQWWQBAXMYBOMA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|