C28H21F2N3O3 — CID 24628139
N,N'-bis(2-fluorophenyl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylidene]propanediamide (PubChem CID 24628139) has the molecular formula C28H21F2N3O3 and a molecular weight of 485.49 g/mol. Its IUPAC name is N,N'-bis(2-fluorophenyl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylidene]propanediamide.
| Compound Name | N,N'-bis(2-fluorophenyl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylidene]propanediamide |
|---|---|
| PubChem CID | 24628139 |
| Molecular Formula | C28H21F2N3O3 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N,N'-bis(2-fluorophenyl)-2-[[2-(pyridin-2-ylmethoxy)phenyl]methylidene]propanediamide |
| SMILES | O=C(Nc1ccccc1F)C(=Cc1ccccc1OCc1ccccn1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C28H21F2N3O3/c29-22-11-2-4-13-24(22)32-27(34)21(28(35)33-25-14-5-3-12-23(25)30)17-19-9-1-6-15-26(19)36-18-20-10-7-8-16-31-20/h1-17H,18H2,(H,32,34)(H,33,35) |
| InChIKey | PLXCROPNYYHJIU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|