C21H21N5O4S — CID 24650294
5-phenyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1H-pyrazole-4-carbohydrazide (PubChem CID 24650294) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 5-phenyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1H-pyrazole-4-carbohydrazide.
| Compound Name | 5-phenyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24650294 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 5-phenyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1H-pyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn[nH]c1-c1ccccc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H21N5O4S/c27-20(16-8-10-17(11-9-16)31(29,30)26-12-4-5-13-26)24-25-21(28)18-14-22-23-19(18)15-6-2-1-3-7-15/h1-3,6-11,14H,4-5,12-13H2,(H,22,23)(H,24,27)(H,25,28) |
| InChIKey | GVZMXNUTLHLTEK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|