C25H29N3O5 — CID 24651951
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(4,6-dimethyl-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)propanoate (PubChem CID 24651951) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(4,6-dimethyl-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)propanoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(4,6-dimethyl-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)propanoate |
|---|---|
| PubChem CID | 24651951 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(4,6-dimethyl-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)propanoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)CCc2c(C)nc3c(cnn3C(C)C)c2C)c(OC)c1 |
| InChI | InChI=1S/C25H29N3O5/c1-15(2)28-25-20(14-26-28)16(3)19(17(4)27-25)9-12-24(30)33-21-10-7-18(13-22(21)31-5)8-11-23(29)32-6/h7-8,10-11,13-15H,9,12H2,1-6H3/b11-8+ |
| InChIKey | SDYLWKAATLZZPC-DHZHZOJOSA-N |
| XLogP | 4.36 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|