C29H29NO4 — CID 24655878
4-(3,4-dimethoxyphenyl)-4-oxo-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)butanamide (PubChem CID 24655878) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4-oxo-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)butanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-4-oxo-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)butanamide |
|---|---|
| PubChem CID | 24655878 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4-oxo-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)butanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)NCC2CC3c4ccccc4C2c2ccccc23)cc1OC |
| InChI | InChI=1S/C29H29NO4/c1-33-26-13-11-18(16-27(26)34-2)25(31)12-14-28(32)30-17-19-15-24-20-7-3-5-9-22(20)29(19)23-10-6-4-8-21(23)24/h3-11,13,16,19,24,29H,12,14-15,17H2,1-2H3,(H,30,32) |
| InChIKey | DUDOUXQONVXLBH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |