C28H26F2N2O4 — CID 55522292
4-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethylamino)ethyl]benzamide (PubChem CID 55522292) has the molecular formula C28H26F2N2O4 and a molecular weight of 492.52 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethylamino)ethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55522292 |
| Molecular Formula | C28H26F2N2O4 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[2-oxo-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethylamino)ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCC2CC3c4ccccc4C2c2ccccc23)ccc1OC(F)F |
| InChI | InChI=1S/C28H26F2N2O4/c1-35-24-13-16(10-11-23(24)36-28(29)30)27(34)32-15-25(33)31-14-17-12-22-18-6-2-4-8-20(18)26(17)21-9-5-3-7-19(21)22/h2-11,13,17,22,26,28H,12,14-15H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | VWHIDEARCAEKMT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |