C22H25N3O2S — CID 24665481
2,2-dimethyl-N-[4-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)thiophen-2-yl]propanamide (PubChem CID 24665481) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)thiophen-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)thiophen-2-yl]propanamide |
|---|---|
| PubChem CID | 24665481 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2,2-dimethyl-N-[4-methyl-5-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)thiophen-2-yl]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C22H25N3O2S/c1-13-11-18(24-21(27)22(2,3)4)28-19(13)20(26)25-10-9-17-15(12-25)14-7-5-6-8-16(14)23-17/h5-8,11,23H,9-10,12H2,1-4H3,(H,24,27) |
| InChIKey | STDYVOKOCAOOHP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|