C19H24N4O5S2 — CID 24670458
4-[3-[ethyl-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]propanoylamino]benzamide (PubChem CID 24670458) has the molecular formula C19H24N4O5S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 4-[3-[ethyl-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]propanoylamino]benzamide.
| Compound Name | 4-[3-[ethyl-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 24670458 |
| Molecular Formula | C19H24N4O5S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[3-[ethyl-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]amino]propanoylamino]benzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)C(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H24N4O5S2/c1-3-23(17(25)13-22(2)30(27,28)18-5-4-12-29-18)11-10-16(24)21-15-8-6-14(7-9-15)19(20)26/h4-9,12H,3,10-11,13H2,1-2H3,(H2,20,26)(H,21,24) |
| InChIKey | WXEQINWIDCILBX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |