C9H11N3O2S2 — CID 24710948
2-amino-N-(1,3-benzothiazol-2-yl)ethanesulfonamide (PubChem CID 24710948) has the molecular formula C9H11N3O2S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzothiazol-2-yl)ethanesulfonamide.
| Compound Name | 2-amino-N-(1,3-benzothiazol-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 24710948 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-amino-N-(1,3-benzothiazol-2-yl)ethanesulfonamide |
| SMILES | NCCS(=O)(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H11N3O2S2/c10-5-6-16(13,14)12-9-11-7-3-1-2-4-8(7)15-9/h1-4H,5-6,10H2,(H,11,12) |
| InChIKey | CXZOEOHAWRQZNF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |