About 3-iodo-2H-indazol-5-ol
3-iodo-2H-indazol-5-ol (PubChem CID 24728255) has the molecular formula C7H5IN2O
and a molecular weight of 260.03 g/mol. Its IUPAC name is 3-iodo-2H-indazol-5-ol.
Molecular Properties
| Compound Name | 3-iodo-2H-indazol-5-ol |
| PubChem CID | 24728255 |
| Molecular Formula | C7H5IN2O |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | 3-iodo-2H-indazol-5-ol |
| SMILES | Oc1ccc2n[nH]c(I)c2c1 |
| InChI | InChI=1S/C7H5IN2O/c8-7-5-3-4(11)1-2-6(5)9-10-7/h1-3,11H,(H,9,10) |
| InChIKey | VVYKAQOZDUWBOD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2H-indazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2H-indazol-5-ol?
The IUPAC name of 3-iodo-2H-indazol-5-ol (CID 24728255) is 3-iodo-2H-indazol-5-ol.
What is the SMILES notation for 3-iodo-2H-indazol-5-ol?
The canonical SMILES for 3-iodo-2H-indazol-5-ol is Oc1ccc2n[nH]c(I)c2c1.
What is the InChIKey of 3-iodo-2H-indazol-5-ol?
The InChIKey is VVYKAQOZDUWBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2O/c8-7-5-3-4(11)1-2-6(5)9-10-7/h1-3,11H,(H,9,10).
What are the key properties of 3-iodo-2H-indazol-5-ol?
3-iodo-2H-indazol-5-ol has a molecular weight of 260.03 g/mol, XLogP of 1.87, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2H-indazol-5-ol is sourced from PubChem (CID 24728255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).