C23H22F3NO2S2 — CID 24730894
4-(4-thiophen-2-ylphenyl)sulfonyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 24730894) has the molecular formula C23H22F3NO2S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 4-(4-thiophen-2-ylphenyl)sulfonyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-(4-thiophen-2-ylphenyl)sulfonyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 24730894 |
| Molecular Formula | C23H22F3NO2S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-(4-thiophen-2-ylphenyl)sulfonyl-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | O=S(=O)(c1ccc(-c2cccs2)cc1)C1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H22F3NO2S2/c24-23(25,26)19-4-1-3-17(15-19)16-27-12-10-21(11-13-27)31(28,29)20-8-6-18(7-9-20)22-5-2-14-30-22/h1-9,14-15,21H,10-13,16H2 |
| InChIKey | JJXKTXCOJQTSNU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |