C19H18ClF2N3O2 — CID 24734110
7-benzyl-2-(2,4-difluorophenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride (PubChem CID 24734110) has the molecular formula C19H18ClF2N3O2 and a molecular weight of 393.82 g/mol. Its IUPAC name is 7-benzyl-2-(2,4-difluorophenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride.
| Compound Name | 7-benzyl-2-(2,4-difluorophenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 24734110 |
| Molecular Formula | C19H18ClF2N3O2 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 7-benzyl-2-(2,4-difluorophenyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2CN(Cc3ccccc3)CCN2C(=O)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C19H17F2N3O2.ClH/c20-14-6-7-16(15(21)10-14)24-18(25)17-12-22(8-9-23(17)19(24)26)11-13-4-2-1-3-5-13;/h1-7,10,17H,8-9,11-12H2;1H |
| InChIKey | ATLAGQXIEAACJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|