C23H20ClFN6O2S — CID 24738188
5-amino-4-(3-chloro-4-fluoroanilino)-N-(4-morpholin-4-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24738188) has the molecular formula C23H20ClFN6O2S and a molecular weight of 498.97 g/mol. Its IUPAC name is 5-amino-4-(3-chloro-4-fluoroanilino)-N-(4-morpholin-4-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-amino-4-(3-chloro-4-fluoroanilino)-N-(4-morpholin-4-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24738188 |
| Molecular Formula | C23H20ClFN6O2S |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 5-amino-4-(3-chloro-4-fluoroanilino)-N-(4-morpholin-4-ylphenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(N3CCOCC3)cc2)sc2ncnc(Nc3ccc(F)c(Cl)c3)c12 |
| InChI | InChI=1S/C23H20ClFN6O2S/c24-16-11-14(3-6-17(16)25)29-21-18-19(26)20(34-23(18)28-12-27-21)22(32)30-13-1-4-15(5-2-13)31-7-9-33-10-8-31/h1-6,11-12H,7-10,26H2,(H,30,32)(H,27,28,29) |
| InChIKey | MQRAMJIRHMJUGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|